C22H18BrFO5S2 — CID 135004723
(E)-1,1-bis(benzenesulfonyl)-3-bromo-1-fluoro-4-phenylbut-3-en-2-ol (PubChem CID 135004723) has the molecular formula C22H18BrFO5S2 and a molecular weight of 525.42 g/mol. Its IUPAC name is (E)-1,1-bis(benzenesulfonyl)-3-bromo-1-fluoro-4-phenylbut-3-en-2-ol.
| Compound Name | (E)-1,1-bis(benzenesulfonyl)-3-bromo-1-fluoro-4-phenylbut-3-en-2-ol |
|---|---|
| PubChem CID | 135004723 |
| Molecular Formula | C22H18BrFO5S2 |
| Molecular Weight | 525.42 g/mol |
| Exact Mass | 523.98 |
| IUPAC Name | (E)-1,1-bis(benzenesulfonyl)-3-bromo-1-fluoro-4-phenylbut-3-en-2-ol |
| SMILES | O=S(=O)(c1ccccc1)C(F)(C(O)/C(Br)=C\c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18BrFO5S2/c23-20(16-17-10-4-1-5-11-17)21(25)22(24,30(26,27)18-12-6-2-7-13-18)31(28,29)19-14-8-3-9-15-19/h1-16,21,25H/b20-16+ |
| InChIKey | DOEPHOGWSLTIGM-CAPFRKAQSA-N |
| XLogP | 4.35 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |