C16H14F2O3S — CID 11186385
(E)-1-(benzenesulfonyl)-1,1-difluoro-4-phenylbut-3-en-2-ol (PubChem CID 11186385) has the molecular formula C16H14F2O3S and a molecular weight of 324.35 g/mol. Its IUPAC name is (E)-1-(benzenesulfonyl)-1,1-difluoro-4-phenylbut-3-en-2-ol.
| Compound Name | (E)-1-(benzenesulfonyl)-1,1-difluoro-4-phenylbut-3-en-2-ol |
|---|---|
| PubChem CID | 11186385 |
| Molecular Formula | C16H14F2O3S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | (E)-1-(benzenesulfonyl)-1,1-difluoro-4-phenylbut-3-en-2-ol |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H14F2O3S/c17-16(18,22(20,21)14-9-5-2-6-10-14)15(19)12-11-13-7-3-1-4-8-13/h1-12,15,19H/b12-11+ |
| InChIKey | QMEHTFKGZVIEII-VAWYXSNFSA-N |
| XLogP | 3.13 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |