C23H26O4 — CID 135005096
trans-(2S,3S)-3-ethyl-2-[(Z,1R)-1-(furan-2-yl)-3-methoxy-4-oxo-4-phenylbut-2-enyl]cyclohexan-1-one (PubChem CID 135005096) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is trans-(2S,3S)-3-ethyl-2-[(Z,1R)-1-(furan-2-yl)-3-methoxy-4-oxo-4-phenylbut-2-enyl]cyclohexan-1-one.
| Compound Name | trans-(2S,3S)-3-ethyl-2-[(Z,1R)-1-(furan-2-yl)-3-methoxy-4-oxo-4-phenylbut-2-enyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 135005096 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | trans-(2S,3S)-3-ethyl-2-[(Z,1R)-1-(furan-2-yl)-3-methoxy-4-oxo-4-phenylbut-2-enyl]cyclohexan-1-one |
| SMILES | CC[C@H]1CCCC(=O)[C@@H]1[C@@H](/C=C(\OC)C(=O)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C23H26O4/c1-3-16-11-7-12-19(24)22(16)18(20-13-8-14-27-20)15-21(26-2)23(25)17-9-5-4-6-10-17/h4-6,8-10,13-16,18,22H,3,7,11-12H2,1-2H3/b21-15-/t16-,18-,22-/m0/s1 |
| InChIKey | GGVMWFICIRJHTB-YHWZTWDQSA-N |
| XLogP | 5.17 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|