C11H19NO3 — CID 135005558
(2R,3R)-2-cyclohexyl-3-nitropentanal (PubChem CID 135005558) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (2R,3R)-2-cyclohexyl-3-nitropentanal.
| Compound Name | (2R,3R)-2-cyclohexyl-3-nitropentanal |
|---|---|
| PubChem CID | 135005558 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (2R,3R)-2-cyclohexyl-3-nitropentanal |
| SMILES | CC[C@H]([C@H](C=O)C1CCCCC1)[N+](=O)[O-] |
| InChI | InChI=1S/C11H19NO3/c1-2-11(12(14)15)10(8-13)9-6-4-3-5-7-9/h8-11H,2-7H2,1H3/t10-,11-/m1/s1 |
| InChIKey | RHDUNYDUMNELKQ-GHMZBOCLSA-N |
| XLogP | 2.44 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|