C13H22O8 — CID 135005632
3-[(3aR,5R)-6-(ethoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-hydroxypropanoic acid (PubChem CID 135005632) has the molecular formula C13H22O8 and a molecular weight of 306.31 g/mol. Its IUPAC name is 3-[(3aR,5R)-6-(ethoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-hydroxypropanoic acid.
| Compound Name | 3-[(3aR,5R)-6-(ethoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 135005632 |
| Molecular Formula | C13H22O8 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 3-[(3aR,5R)-6-(ethoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-hydroxypropanoic acid |
| SMILES | CCOCOC1C2OC(C)(C)O[C@H]2O[C@@H]1C(O)CC(=O)O |
| InChI | InChI=1S/C13H22O8/c1-4-17-6-18-10-9(7(14)5-8(15)16)19-12-11(10)20-13(2,3)21-12/h7,9-12,14H,4-6H2,1-3H3,(H,15,16)/t7?,9-,10?,11?,12-/m1/s1 |
| InChIKey | BUZZCMIWJSIIAZ-QJWQRLADSA-N |
| XLogP | 0.08 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|