C22H42OSi — CID 135008415
[(3E,6Z,9Z)-4,6-dimethylundeca-3,6,9-trienoxy]-tri(propan-2-yl)silane (PubChem CID 135008415) has the molecular formula C22H42OSi and a molecular weight of 350.66 g/mol. Its IUPAC name is [(3E,6Z,9Z)-4,6-dimethylundeca-3,6,9-trienoxy]-tri(propan-2-yl)silane.
| Compound Name | [(3E,6Z,9Z)-4,6-dimethylundeca-3,6,9-trienoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 135008415 |
| Molecular Formula | C22H42OSi |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | [(3E,6Z,9Z)-4,6-dimethylundeca-3,6,9-trienoxy]-tri(propan-2-yl)silane |
| SMILES | C/C=C\C/C=C(/C)C/C(C)=C/CCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H42OSi/c1-10-11-12-14-21(8)17-22(9)15-13-16-23-24(18(2)3,19(4)5)20(6)7/h10-11,14-15,18-20H,12-13,16-17H2,1-9H3/b11-10-,21-14-,22-15+ |
| InChIKey | FAHUNJAZXOPXFJ-ZAPMHWAFSA-N |
| XLogP | 7.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|