C26H34N2Si — CID 135008525
1,4-ditert-butyl-6,9-diphenyl-1,4-diaza-5-silaspiro[4.4]nona-2,7-diene (PubChem CID 135008525) has the molecular formula C26H34N2Si and a molecular weight of 402.66 g/mol. Its IUPAC name is 1,4-ditert-butyl-6,9-diphenyl-1,4-diaza-5-silaspiro[4.4]nona-2,7-diene.
| Compound Name | 1,4-ditert-butyl-6,9-diphenyl-1,4-diaza-5-silaspiro[4.4]nona-2,7-diene |
|---|---|
| PubChem CID | 135008525 |
| Molecular Formula | C26H34N2Si |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 1,4-ditert-butyl-6,9-diphenyl-1,4-diaza-5-silaspiro[4.4]nona-2,7-diene |
| SMILES | CC(C)(C)N1C=CN(C(C)(C)C)[Si]12C(c1ccccc1)C=CC2c1ccccc1 |
| InChI | InChI=1S/C26H34N2Si/c1-25(2,3)27-19-20-28(26(4,5)6)29(27)23(21-13-9-7-10-14-21)17-18-24(29)22-15-11-8-12-16-22/h7-20,23-24H,1-6H3 |
| InChIKey | MZCKXRMIASSVDU-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|