C20H27BrN2Si — CID 135007639
2-bromo-1,3-ditert-butyl-2-naphthalen-2-yl-1,3,2-diazasilole (PubChem CID 135007639) has the molecular formula C20H27BrN2Si and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-bromo-1,3-ditert-butyl-2-naphthalen-2-yl-1,3,2-diazasilole.
| Compound Name | 2-bromo-1,3-ditert-butyl-2-naphthalen-2-yl-1,3,2-diazasilole |
|---|---|
| PubChem CID | 135007639 |
| Molecular Formula | C20H27BrN2Si |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 2-bromo-1,3-ditert-butyl-2-naphthalen-2-yl-1,3,2-diazasilole |
| SMILES | CC(C)(C)N1C=CN(C(C)(C)C)[Si]1(Br)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H27BrN2Si/c1-19(2,3)22-13-14-23(20(4,5)6)24(22,21)18-12-11-16-9-7-8-10-17(16)15-18/h7-15H,1-6H3 |
| InChIKey | HFOJKMOJOPQEAI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|