C18H22N2O4S — CID 135008647
[4-[(4-methylphenyl)sulfonylamino]anilino] 2,2-dimethylpropanoate (PubChem CID 135008647) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is [4-[(4-methylphenyl)sulfonylamino]anilino] 2,2-dimethylpropanoate.
| Compound Name | [4-[(4-methylphenyl)sulfonylamino]anilino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135008647 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [4-[(4-methylphenyl)sulfonylamino]anilino] 2,2-dimethylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NOC(=O)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C18H22N2O4S/c1-13-5-11-16(12-6-13)25(22,23)20-15-9-7-14(8-10-15)19-24-17(21)18(2,3)4/h5-12,19-20H,1-4H3 |
| InChIKey | KOAGOZHWXWTYKG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|