C23H31NOSi — CID 135009014
(1-benzyl-2,5-dimethylindol-3-yl)oxy-tert-butyl-dimethylsilane (PubChem CID 135009014) has the molecular formula C23H31NOSi and a molecular weight of 365.59 g/mol. Its IUPAC name is (1-benzyl-2,5-dimethylindol-3-yl)oxy-tert-butyl-dimethylsilane.
| Compound Name | (1-benzyl-2,5-dimethylindol-3-yl)oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 135009014 |
| Molecular Formula | C23H31NOSi |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | (1-benzyl-2,5-dimethylindol-3-yl)oxy-tert-butyl-dimethylsilane |
| SMILES | Cc1ccc2c(c1)c(O[Si](C)(C)C(C)(C)C)c(C)n2Cc1ccccc1 |
| InChI | InChI=1S/C23H31NOSi/c1-17-13-14-21-20(15-17)22(25-26(6,7)23(3,4)5)18(2)24(21)16-19-11-9-8-10-12-19/h8-15H,16H2,1-7H3 |
| InChIKey | JGXURYXYQDRRHX-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|