C28H61O6Si3+ — CID 135009712
methyl (3R,4R)-6-[tert-butyl(dimethyl)silyl]oxy-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-trimethylsilyloxypropoxymethyl)hexanoate (PubChem CID 135009712) has the molecular formula C28H61O6Si3+ and a molecular weight of 578.05 g/mol. Its IUPAC name is methyl (3R,4R)-6-[tert-butyl(dimethyl)silyl]oxy-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-trimethylsilyloxypropoxymethyl)hexanoate.
| Compound Name | methyl (3R,4R)-6-[tert-butyl(dimethyl)silyl]oxy-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-trimethylsilyloxypropoxymethyl)hexanoate |
|---|---|
| PubChem CID | 135009712 |
| Molecular Formula | C28H61O6Si3+ |
| Molecular Weight | 578.05 g/mol |
| Exact Mass | 577.38 |
| IUPAC Name | methyl (3R,4R)-6-[tert-butyl(dimethyl)silyl]oxy-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-trimethylsilyloxypropoxymethyl)hexanoate |
| SMILES | COC(=O)C[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@H]([CH+]OCCCO[Si](C)(C)C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H61O6Si3/c1-27(2,3)36(11,12)33-20-16-24(22-26(29)30-7)25(17-21-34-37(13,14)28(4,5)6)23-31-18-15-19-32-35(8,9)10/h23-25H,15-22H2,1-14H3/q+1/t24-,25+/m1/s1 |
| InChIKey | AYAIVBINUJPHAZ-RPBOFIJWSA-N |
| XLogP | 8.03 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.05 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|