C19H42O5Si2 — CID 156686334
3-[dimethyl(trimethylsilyloxy)silyl]propyl 2-ethyl-2,4,4-trimethyl-5-methylperoxypentanoate (PubChem CID 156686334) has the molecular formula C19H42O5Si2 and a molecular weight of 406.71 g/mol. Its IUPAC name is 3-[dimethyl(trimethylsilyloxy)silyl]propyl 2-ethyl-2,4,4-trimethyl-5-methylperoxypentanoate.
| Compound Name | 3-[dimethyl(trimethylsilyloxy)silyl]propyl 2-ethyl-2,4,4-trimethyl-5-methylperoxypentanoate |
|---|---|
| PubChem CID | 156686334 |
| Molecular Formula | C19H42O5Si2 |
| Molecular Weight | 406.71 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 3-[dimethyl(trimethylsilyloxy)silyl]propyl 2-ethyl-2,4,4-trimethyl-5-methylperoxypentanoate |
| SMILES | CCC(C)(CC(C)(C)COOC)C(=O)OCCC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H42O5Si2/c1-11-19(4,15-18(2,3)16-23-21-5)17(20)22-13-12-14-26(9,10)24-25(6,7)8/h11-16H2,1-10H3 |
| InChIKey | HSNTZHSGBXIEBN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.71 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|