C22H46O6Si2 — CID 54077641
6-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 1-O-(2-methoxyethyl) 4-ethyl-2,2,4-trimethylhexanedioate (PubChem CID 54077641) has the molecular formula C22H46O6Si2 and a molecular weight of 462.78 g/mol. Its IUPAC name is 6-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 1-O-(2-methoxyethyl) 4-ethyl-2,2,4-trimethylhexanedioate.
| Compound Name | 6-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 1-O-(2-methoxyethyl) 4-ethyl-2,2,4-trimethylhexanedioate |
|---|---|
| PubChem CID | 54077641 |
| Molecular Formula | C22H46O6Si2 |
| Molecular Weight | 462.78 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 6-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 1-O-(2-methoxyethyl) 4-ethyl-2,2,4-trimethylhexanedioate |
| SMILES | CCC(C)(CC(=O)OCCC[Si](C)(C)O[Si](C)(C)C)CC(C)(C)C(=O)OCCOC |
| InChI | InChI=1S/C22H46O6Si2/c1-11-22(4,18-21(2,3)20(24)27-15-14-25-5)17-19(23)26-13-12-16-30(9,10)28-29(6,7)8/h11-18H2,1-10H3 |
| InChIKey | MKVMJWCNXCKAGD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.78 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|