C28H58O5Si2 — CID 58645060
6-O-[3-[2-[butyl(dimethyl)silyl]ethoxy-dimethylsilyl]propyl] 1-O-(2-methylpropyl) 2-ethyl-2,4,5-trimethylhexanedioate (PubChem CID 58645060) has the molecular formula C28H58O5Si2 and a molecular weight of 530.94 g/mol. Its IUPAC name is 6-O-[3-[2-[butyl(dimethyl)silyl]ethoxy-dimethylsilyl]propyl] 1-O-(2-methylpropyl) 2-ethyl-2,4,5-trimethylhexanedioate.
| Compound Name | 6-O-[3-[2-[butyl(dimethyl)silyl]ethoxy-dimethylsilyl]propyl] 1-O-(2-methylpropyl) 2-ethyl-2,4,5-trimethylhexanedioate |
|---|---|
| PubChem CID | 58645060 |
| Molecular Formula | C28H58O5Si2 |
| Molecular Weight | 530.94 g/mol |
| Exact Mass | 530.38 |
| IUPAC Name | 6-O-[3-[2-[butyl(dimethyl)silyl]ethoxy-dimethylsilyl]propyl] 1-O-(2-methylpropyl) 2-ethyl-2,4,5-trimethylhexanedioate |
| SMILES | CCCC[Si](C)(C)CCO[Si](C)(C)CCCOC(=O)C(C)C(C)CC(C)(CC)C(=O)OCC(C)C |
| InChI | InChI=1S/C28H58O5Si2/c1-12-14-18-34(8,9)20-17-33-35(10,11)19-15-16-31-26(29)25(6)24(5)21-28(7,13-2)27(30)32-22-23(3)4/h23-25H,12-22H2,1-11H3 |
| InChIKey | JQEFJTBSSJZDPE-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.94 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|