C20H40O7Si — CID 23393508
1-O-tert-butyl 5-O-(3-trimethoxysilylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 23393508) has the molecular formula C20H40O7Si and a molecular weight of 420.62 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(3-trimethoxysilylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-(3-trimethoxysilylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 23393508 |
| Molecular Formula | C20H40O7Si |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 1-O-tert-butyl 5-O-(3-trimethoxysilylpropyl) 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OC(C)(C)C)C(=O)OCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C20H40O7Si/c1-11-20(7,15-19(5,6)16(21)27-18(2,3)4)17(22)26-13-12-14-28(23-8,24-9)25-10/h11-15H2,1-10H3 |
| InChIKey | MQFDSGZMPPDDER-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|