C17H34O3Si — CID 58695095
butyl 2-ethyl-2,4,4-trimethyl-5-oxo-5-trimethylsilylpentanoate (PubChem CID 58695095) has the molecular formula C17H34O3Si and a molecular weight of 314.54 g/mol. Its IUPAC name is butyl 2-ethyl-2,4,4-trimethyl-5-oxo-5-trimethylsilylpentanoate.
| Compound Name | butyl 2-ethyl-2,4,4-trimethyl-5-oxo-5-trimethylsilylpentanoate |
|---|---|
| PubChem CID | 58695095 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | butyl 2-ethyl-2,4,4-trimethyl-5-oxo-5-trimethylsilylpentanoate |
| SMILES | CCCCOC(=O)C(C)(CC)CC(C)(C)C(=O)[Si](C)(C)C |
| InChI | InChI=1S/C17H34O3Si/c1-9-11-12-20-14(18)17(5,10-2)13-16(3,4)15(19)21(6,7)8/h9-13H2,1-8H3 |
| InChIKey | LXBUGVJUALBJCV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|