C25H33FN4O3 — CID 135010007
(2S)-N-(5-fluoro-2-pyridinyl)-1-[(2R)-2-[[methyl(phenylmethoxy)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide (PubChem CID 135010007) has the molecular formula C25H33FN4O3 and a molecular weight of 456.56 g/mol. Its IUPAC name is (2S)-N-(5-fluoro-2-pyridinyl)-1-[(2R)-2-[[methyl(phenylmethoxy)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(5-fluoro-2-pyridinyl)-1-[(2R)-2-[[methyl(phenylmethoxy)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 135010007 |
| Molecular Formula | C25H33FN4O3 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | (2S)-N-(5-fluoro-2-pyridinyl)-1-[(2R)-2-[[methyl(phenylmethoxy)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCC[C@H](CN(C)OCc1ccccc1)C(=O)N1CCC[C@H]1C(=O)Nc1ccc(F)cn1 |
| InChI | InChI=1S/C25H33FN4O3/c1-3-4-11-20(17-29(2)33-18-19-9-6-5-7-10-19)25(32)30-15-8-12-22(30)24(31)28-23-14-13-21(26)16-27-23/h5-7,9-10,13-14,16,20,22H,3-4,8,11-12,15,17-18H2,1-2H3,(H,27,28,31)/t20-,22+/m1/s1 |
| InChIKey | VOVYYOJZUJTHNB-IRLDBZIGSA-N |
| XLogP | 4.02 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|