C19H15NO — CID 135011218
6,10b-dihydropyrido[1,2-b]isoindol-6-yl(phenyl)methanone (PubChem CID 135011218) has the molecular formula C19H15NO and a molecular weight of 273.34 g/mol. Its IUPAC name is 6,10b-dihydropyrido[1,2-b]isoindol-6-yl(phenyl)methanone.
| Compound Name | 6,10b-dihydropyrido[1,2-b]isoindol-6-yl(phenyl)methanone |
|---|---|
| PubChem CID | 135011218 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 6,10b-dihydropyrido[1,2-b]isoindol-6-yl(phenyl)methanone |
| SMILES | O=C(c1ccccc1)C1c2ccccc2C2C=CC=CN21 |
| InChI | InChI=1S/C19H15NO/c21-19(14-8-2-1-3-9-14)18-16-11-5-4-10-15(16)17-12-6-7-13-20(17)18/h1-13,17-18H |
| InChIKey | VDNWIVXVKSGTRB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |