C23H42O2Si — CID 135011533
tert-butyl-[(E,3S,8R)-9-[(2S,3S)-3-ethenyloxiran-2-yl]-3,4,8-trimethyl-6-methylidenenon-4-enoxy]-dimethylsilane (PubChem CID 135011533) has the molecular formula C23H42O2Si and a molecular weight of 378.67 g/mol. Its IUPAC name is tert-butyl-[(E,3S,8R)-9-[(2S,3S)-3-ethenyloxiran-2-yl]-3,4,8-trimethyl-6-methylidenenon-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,3S,8R)-9-[(2S,3S)-3-ethenyloxiran-2-yl]-3,4,8-trimethyl-6-methylidenenon-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135011533 |
| Molecular Formula | C23H42O2Si |
| Molecular Weight | 378.67 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | tert-butyl-[(E,3S,8R)-9-[(2S,3S)-3-ethenyloxiran-2-yl]-3,4,8-trimethyl-6-methylidenenon-4-enoxy]-dimethylsilane |
| SMILES | C=C[C@@H]1O[C@H]1C[C@H](C)CC(=C)/C=C(\C)[C@@H](C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O2Si/c1-11-21-22(25-21)16-18(3)14-17(2)15-20(5)19(4)12-13-24-26(9,10)23(6,7)8/h11,15,18-19,21-22H,1-2,12-14,16H2,3-10H3/b20-15+/t18-,19+,21+,22+/m1/s1 |
| InChIKey | ZVPPEJLVLRIJBE-OBZNSKMISA-N |
| XLogP | 6.91 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.67 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|