C21H42O2Si — CID 10784356
[(4S)-4-[(E)-3-[(E)-but-2-enoxy]prop-1-enyl]octoxy]-tert-butyl-dimethylsilane (PubChem CID 10784356) has the molecular formula C21H42O2Si and a molecular weight of 354.65 g/mol. Its IUPAC name is [(4S)-4-[(E)-3-[(E)-but-2-enoxy]prop-1-enyl]octoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(4S)-4-[(E)-3-[(E)-but-2-enoxy]prop-1-enyl]octoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10784356 |
| Molecular Formula | C21H42O2Si |
| Molecular Weight | 354.65 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | [(4S)-4-[(E)-3-[(E)-but-2-enoxy]prop-1-enyl]octoxy]-tert-butyl-dimethylsilane |
| SMILES | C/C=C/COC/C=C/[C@@H](CCCC)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O2Si/c1-8-10-14-20(15-12-18-22-17-11-9-2)16-13-19-23-24(6,7)21(3,4)5/h9,11-12,15,20H,8,10,13-14,16-19H2,1-7H3/b11-9+,15-12+/t20-/m1/s1 |
| InChIKey | RRAOXHMGSCIRHE-APQLGLMVSA-N |
| XLogP | 6.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.65 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|