C21H38O2Si — CID 11089438
triethyl-[(1R,6R)-3-methyl-6-[1-[(2R,3R)-3-(2-methylpropyl)oxiran-2-yl]ethenyl]cyclohex-2-en-1-yl]oxysilane (PubChem CID 11089438) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is triethyl-[(1R,6R)-3-methyl-6-[1-[(2R,3R)-3-(2-methylpropyl)oxiran-2-yl]ethenyl]cyclohex-2-en-1-yl]oxysilane.
| Compound Name | triethyl-[(1R,6R)-3-methyl-6-[1-[(2R,3R)-3-(2-methylpropyl)oxiran-2-yl]ethenyl]cyclohex-2-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 11089438 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | triethyl-[(1R,6R)-3-methyl-6-[1-[(2R,3R)-3-(2-methylpropyl)oxiran-2-yl]ethenyl]cyclohex-2-en-1-yl]oxysilane |
| SMILES | C=C([C@H]1CCC(C)=C[C@H]1O[Si](CC)(CC)CC)[C@H]1O[C@@H]1CC(C)C |
| InChI | InChI=1S/C21H38O2Si/c1-8-24(9-2,10-3)23-19-14-16(6)11-12-18(19)17(7)21-20(22-21)13-15(4)5/h14-15,18-21H,7-13H2,1-6H3/t18-,19-,20-,21-/m1/s1 |
| InChIKey | ITXIWVVDHMPVSE-XRXFAXGQSA-N |
| XLogP | 6.10 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|