C24H24N2O5 — CID 135011560
[2-(indole-1-carbonyl)-1-[(4-methoxyphenyl)methyl]-2-methyl-5-oxopyrrolidin-3-yl] acetate (PubChem CID 135011560) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is [2-(indole-1-carbonyl)-1-[(4-methoxyphenyl)methyl]-2-methyl-5-oxopyrrolidin-3-yl] acetate.
| Compound Name | [2-(indole-1-carbonyl)-1-[(4-methoxyphenyl)methyl]-2-methyl-5-oxopyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 135011560 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [2-(indole-1-carbonyl)-1-[(4-methoxyphenyl)methyl]-2-methyl-5-oxopyrrolidin-3-yl] acetate |
| SMILES | COc1ccc(CN2C(=O)CC(OC(C)=O)C2(C)C(=O)n2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C24H24N2O5/c1-16(27)31-21-14-22(28)26(15-17-8-10-19(30-3)11-9-17)24(21,2)23(29)25-13-12-18-6-4-5-7-20(18)25/h4-13,21H,14-15H2,1-3H3 |
| InChIKey | BSLHZXREMYEOBD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |