C13H18O4 — CID 135011917
6-[(1E,3Z,6R)-6-hydroxyhepta-1,3-dienyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 135011917) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 6-[(1E,3Z,6R)-6-hydroxyhepta-1,3-dienyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(1E,3Z,6R)-6-hydroxyhepta-1,3-dienyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 135011917 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 6-[(1E,3Z,6R)-6-hydroxyhepta-1,3-dienyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | C[C@@H](O)C/C=C\C=C\C1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C13H18O4/c1-10(14)7-5-4-6-8-11-9-12(15)17-13(2,3)16-11/h4-6,8-10,14H,7H2,1-3H3/b5-4-,8-6+/t10-/m1/s1 |
| InChIKey | UNIQZQJRRYYITN-ILFBQWLFSA-N |
| XLogP | 2.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|