C20H18F6N2O3S — CID 135012157
methyl (2S)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-3-phenylmethoxypropanoate (PubChem CID 135012157) has the molecular formula C20H18F6N2O3S and a molecular weight of 480.43 g/mol. Its IUPAC name is methyl (2S)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-3-phenylmethoxypropanoate.
| Compound Name | methyl (2S)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-3-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 135012157 |
| Molecular Formula | C20H18F6N2O3S |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | methyl (2S)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-3-phenylmethoxypropanoate |
| SMILES | COC(=O)[C@H](COCc1ccccc1)NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18F6N2O3S/c1-30-17(29)16(11-31-10-12-5-3-2-4-6-12)28-18(32)27-15-8-13(19(21,22)23)7-14(9-15)20(24,25)26/h2-9,16H,10-11H2,1H3,(H2,27,28,32)/t16-/m0/s1 |
| InChIKey | SGKMWIUZZHOEER-INIZCTEOSA-N |
| XLogP | 4.77 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|