C24H27NO — CID 135013050
(2S)-2-(dimethylamino)-2-methyl-1,1,3-triphenylpropan-1-ol (PubChem CID 135013050) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is (2S)-2-(dimethylamino)-2-methyl-1,1,3-triphenylpropan-1-ol.
| Compound Name | (2S)-2-(dimethylamino)-2-methyl-1,1,3-triphenylpropan-1-ol |
|---|---|
| PubChem CID | 135013050 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (2S)-2-(dimethylamino)-2-methyl-1,1,3-triphenylpropan-1-ol |
| SMILES | CN(C)[C@@](C)(Cc1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27NO/c1-23(25(2)3,19-20-13-7-4-8-14-20)24(26,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18,26H,19H2,1-3H3/t23-/m0/s1 |
| InChIKey | QGEQFBBJXJROMO-QHCPKHFHSA-N |
| XLogP | 4.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |