C21H27NO5 — CID 135013068
[(2S,6R)-5-ethenyl-2-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-phenyl-3,6-dihydro-2H-pyridin-1-yl] acetate (PubChem CID 135013068) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is [(2S,6R)-5-ethenyl-2-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-phenyl-3,6-dihydro-2H-pyridin-1-yl] acetate.
| Compound Name | [(2S,6R)-5-ethenyl-2-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-phenyl-3,6-dihydro-2H-pyridin-1-yl] acetate |
|---|---|
| PubChem CID | 135013068 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | [(2S,6R)-5-ethenyl-2-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-phenyl-3,6-dihydro-2H-pyridin-1-yl] acetate |
| SMILES | C=CC1=CC[C@@H]([C@@H]2OC(C)(C)O[C@@H]2CO)N(OC(C)=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H27NO5/c1-5-15-11-12-17(20-18(13-23)25-21(3,4)26-20)22(27-14(2)24)19(15)16-9-7-6-8-10-16/h5-11,17-20,23H,1,12-13H2,2-4H3/t17-,18+,19+,20-/m0/s1 |
| InChIKey | BIELXGXEUSCDCI-NMLBUPMWSA-N |
| XLogP | 2.90 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |