C29H33N3O8 — CID 135013320
tert-butyl (4R)-5-[[(2S)-1-(1H-indol-3-yl)-3-methoxy-1,3-dioxopropan-2-yl]amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 135013320) has the molecular formula C29H33N3O8 and a molecular weight of 551.60 g/mol. Its IUPAC name is tert-butyl (4R)-5-[[(2S)-1-(1H-indol-3-yl)-3-methoxy-1,3-dioxopropan-2-yl]amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | tert-butyl (4R)-5-[[(2S)-1-(1H-indol-3-yl)-3-methoxy-1,3-dioxopropan-2-yl]amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 135013320 |
| Molecular Formula | C29H33N3O8 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | tert-butyl (4R)-5-[[(2S)-1-(1H-indol-3-yl)-3-methoxy-1,3-dioxopropan-2-yl]amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)[C@@H](NC(=O)[C@@H](CCC(=O)OC(C)(C)C)NC(=O)OCc1ccccc1)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H33N3O8/c1-29(2,3)40-23(33)15-14-22(31-28(37)39-17-18-10-6-5-7-11-18)26(35)32-24(27(36)38-4)25(34)20-16-30-21-13-9-8-12-19(20)21/h5-13,16,22,24,30H,14-15,17H2,1-4H3,(H,31,37)(H,32,35)/t22-,24+/m1/s1 |
| InChIKey | AYBBDFYQWZSJIB-VWNXMTODSA-N |
| XLogP | 3.43 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|