C17H25NO6 — CID 135013512
methyl (4S)-4-[benzyl(hydroxy)amino]-4-[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]butanoate (PubChem CID 135013512) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is methyl (4S)-4-[benzyl(hydroxy)amino]-4-[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]butanoate.
| Compound Name | methyl (4S)-4-[benzyl(hydroxy)amino]-4-[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]butanoate |
|---|---|
| PubChem CID | 135013512 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | methyl (4S)-4-[benzyl(hydroxy)amino]-4-[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]butanoate |
| SMILES | COC(=O)CC[C@@H]([C@@H]1O[C@H](C)OC[C@H]1O)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C17H25NO6/c1-12-23-11-15(19)17(24-12)14(8-9-16(20)22-2)18(21)10-13-6-4-3-5-7-13/h3-7,12,14-15,17,19,21H,8-11H2,1-2H3/t12-,14+,15-,17+/m1/s1 |
| InChIKey | IUGHSPIKZFPOOK-JWDQPFGJSA-N |
| XLogP | 1.32 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|