C21H35NO5Si — CID 135013650
benzyl (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,2-dihydroxyethyl)-3-methylpyrrolidine-1-carboxylate (PubChem CID 135013650) has the molecular formula C21H35NO5Si and a molecular weight of 409.60 g/mol. Its IUPAC name is benzyl (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,2-dihydroxyethyl)-3-methylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,2-dihydroxyethyl)-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135013650 |
| Molecular Formula | C21H35NO5Si |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | benzyl (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,2-dihydroxyethyl)-3-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CN(C(=O)OCc2ccccc2)[C@@H]1C(O)CO |
| InChI | InChI=1S/C21H35NO5Si/c1-15-18(27-28(5,6)21(2,3)4)12-22(19(15)17(24)13-23)20(25)26-14-16-10-8-7-9-11-16/h7-11,15,17-19,23-24H,12-14H2,1-6H3/t15-,17?,18-,19-/m0/s1 |
| InChIKey | BGGZMPAJOFSAMC-FYWHIHEHSA-N |
| XLogP | 3.39 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|