C22H35HgNO5Si — CID 135013651
acetyloxy-[[(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-phenylmethoxycarbonylpyrrolidin-2-yl]methyl]mercury (PubChem CID 135013651) has the molecular formula C22H35HgNO5Si and a molecular weight of 622.20 g/mol. Its IUPAC name is acetyloxy-[[(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-phenylmethoxycarbonylpyrrolidin-2-yl]methyl]mercury.
| Compound Name | acetyloxy-[[(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-phenylmethoxycarbonylpyrrolidin-2-yl]methyl]mercury |
|---|---|
| PubChem CID | 135013651 |
| Molecular Formula | C22H35HgNO5Si |
| Molecular Weight | 622.20 g/mol |
| Exact Mass | 623.20 |
| IUPAC Name | acetyloxy-[[(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-phenylmethoxycarbonylpyrrolidin-2-yl]methyl]mercury |
| SMILES | CC(=O)O[Hg]CC1[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H32NO3Si.C2H4O2.Hg/c1-15-16(2)21(13-18(15)24-25(6,7)20(3,4)5)19(22)23-14-17-11-9-8-10-12-17;1-2(3)4;/h8-12,15-16,18H,2,13-14H2,1,3-7H3;1H3,(H,3,4);/q;;+1/p-1/t15-,16?,18+;;/m1../s1 |
| InChIKey | IABRUKMVAWEKKA-UYYJHVIYSA-M |
| XLogP | 5.01 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.20 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|