C23H44O2Si — CID 135014172
(3R,4S,5R,6S)-5-butyl-6-methyl-3-tri(propan-2-yl)silyloxy-2,3,4,5,6,7-hexahydro-1H-inden-4-ol (PubChem CID 135014172) has the molecular formula C23H44O2Si and a molecular weight of 380.69 g/mol. Its IUPAC name is (3R,4S,5R,6S)-5-butyl-6-methyl-3-tri(propan-2-yl)silyloxy-2,3,4,5,6,7-hexahydro-1H-inden-4-ol.
| Compound Name | (3R,4S,5R,6S)-5-butyl-6-methyl-3-tri(propan-2-yl)silyloxy-2,3,4,5,6,7-hexahydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 135014172 |
| Molecular Formula | C23H44O2Si |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | (3R,4S,5R,6S)-5-butyl-6-methyl-3-tri(propan-2-yl)silyloxy-2,3,4,5,6,7-hexahydro-1H-inden-4-ol |
| SMILES | CCCC[C@H]1[C@H](O)C2=C(CC[C@H]2O[Si](C(C)C)(C(C)C)C(C)C)C[C@@H]1C |
| InChI | InChI=1S/C23H44O2Si/c1-9-10-11-20-18(8)14-19-12-13-21(22(19)23(20)24)25-26(15(2)3,16(4)5)17(6)7/h15-18,20-21,23-24H,9-14H2,1-8H3/t18-,20+,21+,23-/m0/s1 |
| InChIKey | UJKLCZSZESCIRH-NQAVQENRSA-N |
| XLogP | 6.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|