C16H26O2 — CID 135014474
ethyl 4-[(1S,2R)-2-ethenyl-4,4-dimethylcyclopentyl]-2-methylidenebutanoate (PubChem CID 135014474) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is ethyl 4-[(1S,2R)-2-ethenyl-4,4-dimethylcyclopentyl]-2-methylidenebutanoate.
| Compound Name | ethyl 4-[(1S,2R)-2-ethenyl-4,4-dimethylcyclopentyl]-2-methylidenebutanoate |
|---|---|
| PubChem CID | 135014474 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | ethyl 4-[(1S,2R)-2-ethenyl-4,4-dimethylcyclopentyl]-2-methylidenebutanoate |
| SMILES | C=C[C@H]1CC(C)(C)C[C@@H]1CCC(=C)C(=O)OCC |
| InChI | InChI=1S/C16H26O2/c1-6-13-10-16(4,5)11-14(13)9-8-12(3)15(17)18-7-2/h6,13-14H,1,3,7-11H2,2,4-5H3/t13-,14-/m0/s1 |
| InChIKey | OKMKMZKSVXJZTH-KBPBESRZSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|