C28H35NO2 — CID 135014482
ethyl (2S,3S,4Z,7E)-1-benzyl-5-butyl-2-methyl-3-phenyl-3,6-dihydro-2H-azocine-7-carboxylate (PubChem CID 135014482) has the molecular formula C28H35NO2 and a molecular weight of 417.59 g/mol. Its IUPAC name is ethyl (2S,3S,4Z,7E)-1-benzyl-5-butyl-2-methyl-3-phenyl-3,6-dihydro-2H-azocine-7-carboxylate.
| Compound Name | ethyl (2S,3S,4Z,7E)-1-benzyl-5-butyl-2-methyl-3-phenyl-3,6-dihydro-2H-azocine-7-carboxylate |
|---|---|
| PubChem CID | 135014482 |
| Molecular Formula | C28H35NO2 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | ethyl (2S,3S,4Z,7E)-1-benzyl-5-butyl-2-methyl-3-phenyl-3,6-dihydro-2H-azocine-7-carboxylate |
| SMILES | CCCC/C1=C/[C@@H](c2ccccc2)[C@H](C)N(Cc2ccccc2)/C=C(/C(=O)OCC)C1 |
| InChI | InChI=1S/C28H35NO2/c1-4-6-13-24-18-26(28(30)31-5-2)21-29(20-23-14-9-7-10-15-23)22(3)27(19-24)25-16-11-8-12-17-25/h7-12,14-17,19,21-22,27H,4-6,13,18,20H2,1-3H3/b24-19-,26-21+/t22-,27+/m0/s1 |
| InChIKey | OXHSYLCIORRIDS-PKPVRGBXSA-N |
| XLogP | 6.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|