C25H31NO2 — CID 135014780
ethyl (2S,3S,7E)-1-benzyl-2,4-dimethyl-3-phenyl-3,4,5,6-tetrahydro-2H-azocine-7-carboxylate (PubChem CID 135014780) has the molecular formula C25H31NO2 and a molecular weight of 377.53 g/mol. Its IUPAC name is ethyl (2S,3S,7E)-1-benzyl-2,4-dimethyl-3-phenyl-3,4,5,6-tetrahydro-2H-azocine-7-carboxylate.
| Compound Name | ethyl (2S,3S,7E)-1-benzyl-2,4-dimethyl-3-phenyl-3,4,5,6-tetrahydro-2H-azocine-7-carboxylate |
|---|---|
| PubChem CID | 135014780 |
| Molecular Formula | C25H31NO2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | ethyl (2S,3S,7E)-1-benzyl-2,4-dimethyl-3-phenyl-3,4,5,6-tetrahydro-2H-azocine-7-carboxylate |
| SMILES | CCOC(=O)/C1=C/N(Cc2ccccc2)[C@@H](C)[C@H](c2ccccc2)C(C)CC1 |
| InChI | InChI=1S/C25H31NO2/c1-4-28-25(27)23-16-15-19(2)24(22-13-9-6-10-14-22)20(3)26(18-23)17-21-11-7-5-8-12-21/h5-14,18-20,24H,4,15-17H2,1-3H3/b23-18+/t19?,20-,24+/m0/s1 |
| InChIKey | ROIQOJRYHIHQSS-GEVWTOPJSA-N |
| XLogP | 5.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |