C25H44N2 — CID 135014794
N-hexyl-4-(N-hexyl-C-phenylcarbonimidoyl)hexan-3-amine (PubChem CID 135014794) has the molecular formula C25H44N2 and a molecular weight of 372.64 g/mol. Its IUPAC name is N-hexyl-4-(N-hexyl-C-phenylcarbonimidoyl)hexan-3-amine.
| Compound Name | N-hexyl-4-(N-hexyl-C-phenylcarbonimidoyl)hexan-3-amine |
|---|---|
| PubChem CID | 135014794 |
| Molecular Formula | C25H44N2 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.35 |
| IUPAC Name | N-hexyl-4-(N-hexyl-C-phenylcarbonimidoyl)hexan-3-amine |
| SMILES | CCCCCC/N=C(/c1ccccc1)C(CC)C(CC)NCCCCCC |
| InChI | InChI=1S/C25H44N2/c1-5-9-11-16-20-26-24(8-4)23(7-3)25(22-18-14-13-15-19-22)27-21-17-12-10-6-2/h13-15,18-19,23-24,26H,5-12,16-17,20-21H2,1-4H3/b27-25- |
| InChIKey | ROBDNFRXVYCUGX-RFBIWTDZSA-N |
| XLogP | 7.03 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|