C10H16O4 — CID 135015130
1,6,6-trimethyl-4-prop-1-en-2-yl-2,3,7,8-tetraoxabicyclo[3.2.1]octane (PubChem CID 135015130) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 1,6,6-trimethyl-4-prop-1-en-2-yl-2,3,7,8-tetraoxabicyclo[3.2.1]octane.
| Compound Name | 1,6,6-trimethyl-4-prop-1-en-2-yl-2,3,7,8-tetraoxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 135015130 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1,6,6-trimethyl-4-prop-1-en-2-yl-2,3,7,8-tetraoxabicyclo[3.2.1]octane |
| SMILES | C=C(C)C1OOC2(C)OC1C(C)(C)O2 |
| InChI | InChI=1S/C10H16O4/c1-6(2)7-8-9(3,4)13-10(5,11-8)14-12-7/h7-8H,1H2,2-5H3 |
| InChIKey | OTXYKPXRXQWASI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|