C15H28O5 — CID 14489272
(4R,5S)-4-[2-(2-methoxyethoxymethoxy)propan-2-yl]-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolane (PubChem CID 14489272) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is (4R,5S)-4-[2-(2-methoxyethoxymethoxy)propan-2-yl]-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolane.
| Compound Name | (4R,5S)-4-[2-(2-methoxyethoxymethoxy)propan-2-yl]-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolane |
|---|---|
| PubChem CID | 14489272 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (4R,5S)-4-[2-(2-methoxyethoxymethoxy)propan-2-yl]-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolane |
| SMILES | C=C(C)[C@@H]1OC(C)(C)O[C@H]1C(C)(C)OCOCCOC |
| InChI | InChI=1S/C15H28O5/c1-11(2)12-13(20-15(5,6)19-12)14(3,4)18-10-17-9-8-16-7/h12-13H,1,8-10H2,2-7H3/t12-,13+/m0/s1 |
| InChIKey | KFUAMGGLCZFQKY-QWHCGFSZSA-N |
| XLogP | 2.50 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|