C18H30O6 — CID 135015335
[3-acetyloxy-6-(2-ethylhexoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 135015335) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is [3-acetyloxy-6-(2-ethylhexoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-6-(2-ethylhexoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135015335 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | [3-acetyloxy-6-(2-ethylhexoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CCCCC(CC)COC1C=CC(OC(C)=O)C(COC(C)=O)O1 |
| InChI | InChI=1S/C18H30O6/c1-5-7-8-15(6-2)11-22-18-10-9-16(23-14(4)20)17(24-18)12-21-13(3)19/h9-10,15-18H,5-8,11-12H2,1-4H3 |
| InChIKey | UYTRILAISKWFDW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|