C20H34O6 — CID 135015557
(3-acetyloxy-6-decoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate (PubChem CID 135015557) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is (3-acetyloxy-6-decoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate.
| Compound Name | (3-acetyloxy-6-decoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate |
|---|---|
| PubChem CID | 135015557 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (3-acetyloxy-6-decoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate |
| SMILES | CCCCCCCCCCOC1C=CC(OC(C)=O)C(COC(C)=O)O1 |
| InChI | InChI=1S/C20H34O6/c1-4-5-6-7-8-9-10-11-14-23-20-13-12-18(25-17(3)22)19(26-20)15-24-16(2)21/h12-13,18-20H,4-11,14-15H2,1-3H3 |
| InChIKey | NEFQUESHJAQBGK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|