C10H16O5S — CID 135015792
methyl 2-[(2S)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate (PubChem CID 135015792) has the molecular formula C10H16O5S and a molecular weight of 248.30 g/mol. Its IUPAC name is methyl 2-[(2S)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate.
| Compound Name | methyl 2-[(2S)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate |
|---|---|
| PubChem CID | 135015792 |
| Molecular Formula | C10H16O5S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | methyl 2-[(2S)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate |
| SMILES | CCC[C@]1(CC(=O)OC)C(=O)CCS1(=O)=O |
| InChI | InChI=1S/C10H16O5S/c1-3-5-10(7-9(12)15-2)8(11)4-6-16(10,13)14/h3-7H2,1-2H3/t10-/m0/s1 |
| InChIKey | CXSKKNSFNCKFFI-JTQLQIEISA-N |
| XLogP | 0.48 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |