methyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate

C10H16O5S — CID 135055432

IUPACmethyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate
SMILESCCC[C@@]1(CC(=O)OC)C(=O)CCS1(=O)=O
InChIInChI=1S/C10H16O5S/c1-3-5-10(7-9(12)15-2)8(11)4-6-16(10,13)14/h3-7H2,1-2H3/t10-/m1/s1
InChIKeyCXSKKNSFNCKFFI-SNVBAGLBSA-N
MW248.30 g/mol
LogP0.48
Rot. Bonds4

About methyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate

methyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate (PubChem CID 135055432) has the molecular formula C10H16O5S and a molecular weight of 248.30 g/mol. Its IUPAC name is methyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate
PubChem CID135055432
Molecular FormulaC10H16O5S
Molecular Weight248.30 g/mol
Exact Mass248.07
IUPAC Namemethyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate
SMILESCCC[C@@]1(CC(=O)OC)C(=O)CCS1(=O)=O
InChIInChI=1S/C10H16O5S/c1-3-5-10(7-9(12)15-2)8(11)4-6-16(10,13)14/h3-7H2,1-2H3/t10-/m1/s1
InChIKeyCXSKKNSFNCKFFI-SNVBAGLBSA-N
XLogP0.48
TPSA77.51 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.30
LogP ≤ 50.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate?
The IUPAC name of methyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate (CID 135055432) is methyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate.
What is the SMILES notation for methyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate?
The canonical SMILES for methyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate is CCC[C@@]1(CC(=O)OC)C(=O)CCS1(=O)=O.
What is the InChIKey of methyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate?
The InChIKey is CXSKKNSFNCKFFI-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H16O5S/c1-3-5-10(7-9(12)15-2)8(11)4-6-16(10,13)14/h3-7H2,1-2H3/t10-/m1/s1.
What are the key properties of methyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate?
methyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate has a molecular weight of 248.30 g/mol, XLogP of 0.48, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2R)-1,1,3-trioxo-2-propylthiolan-2-yl]acetate is sourced from PubChem (CID 135055432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).