C15H16F3NO3 — CID 135015896
[(2R,3R)-2-phenyl-1-(2,2,2-trifluoroacetyl)piperidin-3-yl] acetate (PubChem CID 135015896) has the molecular formula C15H16F3NO3 and a molecular weight of 315.29 g/mol. Its IUPAC name is [(2R,3R)-2-phenyl-1-(2,2,2-trifluoroacetyl)piperidin-3-yl] acetate.
| Compound Name | [(2R,3R)-2-phenyl-1-(2,2,2-trifluoroacetyl)piperidin-3-yl] acetate |
|---|---|
| PubChem CID | 135015896 |
| Molecular Formula | C15H16F3NO3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | [(2R,3R)-2-phenyl-1-(2,2,2-trifluoroacetyl)piperidin-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CCCN(C(=O)C(F)(F)F)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H16F3NO3/c1-10(20)22-12-8-5-9-19(14(21)15(16,17)18)13(12)11-6-3-2-4-7-11/h2-4,6-7,12-13H,5,8-9H2,1H3/t12-,13-/m1/s1 |
| InChIKey | OLALNGJPWVQPMT-CHWSQXEVSA-N |
| XLogP | 2.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |