C17H20F3NO4 — CID 45230667
methyl 4-oxo-4-[2-[[3-(trifluoromethyl)phenyl]methyl]morpholin-4-yl]butanoate (PubChem CID 45230667) has the molecular formula C17H20F3NO4 and a molecular weight of 359.34 g/mol. Its IUPAC name is methyl 4-oxo-4-[2-[[3-(trifluoromethyl)phenyl]methyl]morpholin-4-yl]butanoate.
| Compound Name | methyl 4-oxo-4-[2-[[3-(trifluoromethyl)phenyl]methyl]morpholin-4-yl]butanoate |
|---|---|
| PubChem CID | 45230667 |
| Molecular Formula | C17H20F3NO4 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | methyl 4-oxo-4-[2-[[3-(trifluoromethyl)phenyl]methyl]morpholin-4-yl]butanoate |
| SMILES | COC(=O)CCC(=O)N1CCOC(Cc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C17H20F3NO4/c1-24-16(23)6-5-15(22)21-7-8-25-14(11-21)10-12-3-2-4-13(9-12)17(18,19)20/h2-4,9,14H,5-8,10-11H2,1H3 |
| InChIKey | LWUGNEVQAGNAQU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |