C25H16F2O3 — CID 135016207
6,7-bis(4-fluorophenyl)-4-phenyl-3,7a-dihydrofuro[3,4-c]pyran-1-one (PubChem CID 135016207) has the molecular formula C25H16F2O3 and a molecular weight of 402.40 g/mol. Its IUPAC name is 6,7-bis(4-fluorophenyl)-4-phenyl-3,7a-dihydrofuro[3,4-c]pyran-1-one.
| Compound Name | 6,7-bis(4-fluorophenyl)-4-phenyl-3,7a-dihydrofuro[3,4-c]pyran-1-one |
|---|---|
| PubChem CID | 135016207 |
| Molecular Formula | C25H16F2O3 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 6,7-bis(4-fluorophenyl)-4-phenyl-3,7a-dihydrofuro[3,4-c]pyran-1-one |
| SMILES | O=C1OCC2=C(c3ccccc3)OC(c3ccc(F)cc3)=C(c3ccc(F)cc3)C12 |
| InChI | InChI=1S/C25H16F2O3/c26-18-10-6-15(7-11-18)21-22-20(14-29-25(22)28)23(16-4-2-1-3-5-16)30-24(21)17-8-12-19(27)13-9-17/h1-13,22H,14H2 |
| InChIKey | DRDQARSBKOHIMQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|