C22H42O3Si — CID 135016413
[(4R,5S,6R,7S)-5-[tert-butyl(dimethyl)silyl]oxy-6,7-dimethylundec-1-en-4-yl] prop-2-enoate (PubChem CID 135016413) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is [(4R,5S,6R,7S)-5-[tert-butyl(dimethyl)silyl]oxy-6,7-dimethylundec-1-en-4-yl] prop-2-enoate.
| Compound Name | [(4R,5S,6R,7S)-5-[tert-butyl(dimethyl)silyl]oxy-6,7-dimethylundec-1-en-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 135016413 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | [(4R,5S,6R,7S)-5-[tert-butyl(dimethyl)silyl]oxy-6,7-dimethylundec-1-en-4-yl] prop-2-enoate |
| SMILES | C=CC[C@@H](OC(=O)C=C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](C)CCCC |
| InChI | InChI=1S/C22H42O3Si/c1-11-14-16-17(4)18(5)21(25-26(9,10)22(6,7)8)19(15-12-2)24-20(23)13-3/h12-13,17-19,21H,2-3,11,14-16H2,1,4-10H3/t17-,18+,19+,21-/m0/s1 |
| InChIKey | BVQLETXUPQRXLG-PXCRPINLSA-N |
| XLogP | 6.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|