C18H17NO3 — CID 135016438
[(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl] benzoate (PubChem CID 135016438) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl] benzoate.
| Compound Name | [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl] benzoate |
|---|---|
| PubChem CID | 135016438 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl] benzoate |
| SMILES | CO/N=C1\CCCc2cccc(OC(=O)c3ccccc3)c21 |
| InChI | InChI=1S/C18H17NO3/c1-21-19-15-11-5-9-13-10-6-12-16(17(13)15)22-18(20)14-7-3-2-4-8-14/h2-4,6-8,10,12H,5,9,11H2,1H3/b19-15+ |
| InChIKey | SKOPJKNZTQGLNE-XDJHFCHBSA-N |
| XLogP | 3.59 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|