C19H23NO3 — CID 51041194
methyl (2E,6E)-7-[(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]hepta-2,6-dienoate (PubChem CID 51041194) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is methyl (2E,6E)-7-[(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]hepta-2,6-dienoate.
| Compound Name | methyl (2E,6E)-7-[(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]hepta-2,6-dienoate |
|---|---|
| PubChem CID | 51041194 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | methyl (2E,6E)-7-[(8E)-8-methoxyimino-6,7-dihydro-5H-naphthalen-1-yl]hepta-2,6-dienoate |
| SMILES | CO/N=C1\CCCc2cccc(/C=C/CC/C=C/C(=O)OC)c21 |
| InChI | InChI=1S/C19H23NO3/c1-22-18(21)14-6-4-3-5-9-15-10-7-11-16-12-8-13-17(19(15)16)20-23-2/h5-7,9-11,14H,3-4,8,12-13H2,1-2H3/b9-5+,14-6+,20-17+ |
| InChIKey | GYSKCAAOKVIDLU-MLSDZBQASA-N |
| XLogP | 3.90 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|