C13H15NO2 — CID 169479132
methyl 3-(1,2,3,4-tetrahydroisoquinolin-5-yl)prop-2-enoate (PubChem CID 169479132) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is methyl 3-(1,2,3,4-tetrahydroisoquinolin-5-yl)prop-2-enoate.
| Compound Name | methyl 3-(1,2,3,4-tetrahydroisoquinolin-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 169479132 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | methyl 3-(1,2,3,4-tetrahydroisoquinolin-5-yl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1cccc2c1CCNC2 |
| InChI | InChI=1S/C13H15NO2/c1-16-13(15)6-5-10-3-2-4-11-9-14-8-7-12(10)11/h2-6,14H,7-9H2,1H3 |
| InChIKey | MNLGFMFERXWJIU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|