C20H21ClN2O3 — CID 135016706
methyl N-[2-[3-chloro-2-[(1S)-1-phenylethyl]iminooxolan-3-yl]phenyl]carbamate (PubChem CID 135016706) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is methyl N-[2-[3-chloro-2-[(1S)-1-phenylethyl]iminooxolan-3-yl]phenyl]carbamate.
| Compound Name | methyl N-[2-[3-chloro-2-[(1S)-1-phenylethyl]iminooxolan-3-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 135016706 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | methyl N-[2-[3-chloro-2-[(1S)-1-phenylethyl]iminooxolan-3-yl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccccc1C1(Cl)CCO/C1=N\[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C20H21ClN2O3/c1-14(15-8-4-3-5-9-15)22-18-20(21,12-13-26-18)16-10-6-7-11-17(16)23-19(24)25-2/h3-11,14H,12-13H2,1-2H3,(H,23,24)/b22-18-/t14-,20?/m0/s1 |
| InChIKey | JNLNEIBEQNWDLZ-FWPQSRNOSA-N |
| XLogP | 4.88 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|