C16H21NO3 — CID 91369386
methyl 2-methyl-4-[(1R)-1-phenylethyl]iminooxane-3-carboxylate (PubChem CID 91369386) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is methyl 2-methyl-4-[(1R)-1-phenylethyl]iminooxane-3-carboxylate.
| Compound Name | methyl 2-methyl-4-[(1R)-1-phenylethyl]iminooxane-3-carboxylate |
|---|---|
| PubChem CID | 91369386 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | methyl 2-methyl-4-[(1R)-1-phenylethyl]iminooxane-3-carboxylate |
| SMILES | COC(=O)C1/C(=N/[C@H](C)c2ccccc2)CCOC1C |
| InChI | InChI=1S/C16H21NO3/c1-11(13-7-5-4-6-8-13)17-14-9-10-20-12(2)15(14)16(18)19-3/h4-8,11-12,15H,9-10H2,1-3H3/b17-14+/t11-,12?,15?/m1/s1 |
| InChIKey | FUXPWAGBLCYJNM-ZMQYKTDRSA-N |
| XLogP | 2.79 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|